Difference between revisions of "DIACYLGLYCEROL-PYROPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13228 RXN-13228] == * direction: ** left-to-right == Reaction formula == * 1 N-methyl-termina...") |
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PHENYL-PYRUVATE == |
| − | * | + | * common-name: |
| − | ** | + | ** keto-phenylpyruvate |
| − | == Reaction | + | * smiles: |
| − | * | + | ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) |
| − | == | + | * inchi-key: |
| − | * | + | ** btnmpgbkdvtsjy-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | * | + | ** 163.152 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[2.6.1.64-RXN]] | |
| − | * | + | * [[PHEAMINOTRANS-RXN]] |
| − | == | + | * [[PREPHENATEDEHYDRAT-RXN]] |
| − | {{#set: | + | * [[RXN-10814]] |
| − | {{#set: | + | * [[RXN-10815]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[2.6.1.64-RXN]] |
| − | + | * [[PHEAMINOTRANS-RXN]] | |
| − | + | * [[PPDH]] | |
| − | + | * [[PREPHENATEDEHYDRAT-RXN]] | |
| + | * [[RXN-10814]] | ||
| + | * [[RXN-17130]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=keto-phenylpyruvate}} | ||
| + | {{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=163.152}} | ||
Revision as of 20:37, 18 December 2020
Contents
Metabolite PHENYL-PYRUVATE
- common-name:
- keto-phenylpyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cc=cc=c1)
- inchi-key:
- btnmpgbkdvtsjy-uhfffaoysa-m
- molecular-weight:
- 163.152
