Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-seryl-SEC-tRNAs == * common-name: ** an l-seryl-[trnasec] == Reaction(s) known to consume the compound == * RXN-10038 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one * smiles: ** c(c2(c(o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-seryl-SEC-tRNAs ==
+
== Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR ==
 
* common-name:
 
* common-name:
** an l-seryl-[trnasec]
+
** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one
 +
* smiles:
 +
** c(c2(c(o)c(o)c(nc1(=c(n)c(=o)nc(=n1)n))o2))op(=o)([o-])[o-]
 +
* inchi-key:
 +
** oclclrxknjcojd-ummcilcdsa-l
 +
* molecular-weight:
 +
** 351.212
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10038]]
+
* [[RIBOFLAVINSYNDEAM-RXN]]
 +
* [[RXN-10057]]
 +
* [[RXN-14171]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10038]]
+
* [[GTP-CYCLOHYDRO-II-RXN]]
* [[RXN0-2161]]
+
* [[RXN-14171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-seryl-[trnasec]}}
+
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one}}
 +
{{#set: inchi-key=inchikey=oclclrxknjcojd-ummcilcdsa-l}}
 +
{{#set: molecular-weight=351.212}}

Latest revision as of 11:15, 18 March 2021

Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR

  • common-name:
    • 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one
  • smiles:
    • c(c2(c(o)c(o)c(nc1(=c(n)c(=o)nc(=n1)n))o2))op(=o)([o-])[o-]
  • inchi-key:
    • oclclrxknjcojd-ummcilcdsa-l
  • molecular-weight:
    • 351.212

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality