Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15775 RXN-15775] == * direction: ** left-to-right * common-name: ** diphthine synthase * ec-num...")
(Created page with "Category:metabolite == Metabolite CPD-7649 == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1) * inchi-key: ** nzkryjgnypyxjz-u...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15775 RXN-15775] ==
+
== Metabolite CPD-7649 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** diphthine synthase
+
** dopamine 3-o-sulfate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.314 ec-2.1.1.314]
+
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE]][c] '''+''' 4 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 4 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[Diphthine-methyl-ester-EF2]][c] '''+''' 3 [[PROTON]][c]
+
** nzkryjgnypyxjz-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ08595]]
+
** 233.239
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN6666-9]]
−
* [[PWY-7546]], diphthamide biosynthesis II (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=dopamine 3-o-sulfate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=233.239}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42653 42653]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=diphthine synthase}}
 
−
{{#set: ec-number=ec-2.1.1.314}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-7649

  • common-name:
    • dopamine 3-o-sulfate
  • smiles:
    • c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
  • inchi-key:
    • nzkryjgnypyxjz-uhfffaoysa-n
  • molecular-weight:
    • 233.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR&oldid=47445"