Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
(Created page with "Category:metabolite == Metabolite CPD0-2113 == * common-name: ** 1-stearoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-] * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GDP-D-GLUCOSE ==
+
== Metabolite CPD0-2113 ==
 
* common-name:
 
* common-name:
** gdp-α-d-glucose
+
** 1-stearoyl-sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
+
** cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** mvmscbbuihutgj-lrjdveewsa-l
+
** layxstyjrsvxih-hxuwfjfhsa-l
 
* molecular-weight:
 
* molecular-weight:
** 603.329
+
** 436.524
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12486]]
+
* [[RXN-16025]]
 +
* [[RXN-16067]]
 +
* [[RXN-16076]]
 +
* [[RXN-16077]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12486]]
+
* [[RXN-16024]]
* [[RXN4FS-13]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-glucose}}
+
{{#set: common-name=1-stearoyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
+
{{#set: inchi-key=inchikey=layxstyjrsvxih-hxuwfjfhsa-l}}
{{#set: molecular-weight=603.329}}
+
{{#set: molecular-weight=436.524}}

Revision as of 13:11, 14 January 2021

Metabolite CPD0-2113

  • common-name:
    • 1-stearoyl-sn-glycerol 3-phosphate
  • smiles:
    • cccccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
  • inchi-key:
    • layxstyjrsvxih-hxuwfjfhsa-l
  • molecular-weight:
    • 436.524

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality