Difference between revisions of "DIAMINONONANOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-292 == * common-name: ** (2e)-hexadecenal * smiles: ** cccccccccccccc=c[ch]=o * inchi-key: ** kljfyxovgvxzkt-ccezhusrsa-n * molecular...") |
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIAMINONONANOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-diaminopelargonate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(cccccc([o-])=o)[n+])[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kcegbpiygiwcdh-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.277 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DAPASYN-RXN]] |
| + | * [[DETHIOBIOTIN-SYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DAPASYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-diaminopelargonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.277}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DIAMINONONANOATE
- common-name:
- 7,8-diaminopelargonate
- smiles:
- cc(c(cccccc([o-])=o)[n+])[n+]
- inchi-key:
- kcegbpiygiwcdh-uhfffaoysa-o
- molecular-weight:
- 189.277
