Difference between revisions of "DIETHYLPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7139 == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(c...")
(Created page with "Category:metabolite == Metabolite 3-oxo-hexanoyl-ACPs == * common-name: ** a 3-oxo-hexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9518 == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7139 ==
+
== Metabolite 3-oxo-hexanoyl-ACPs ==
 
* common-name:
 
* common-name:
** delphinidin 3,5-di-o-β-d-glucoside
+
** a 3-oxo-hexanoyl-[acp]
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
 
* inchi-key:
 
** xctgxgvgjyacei-lcenjuansa-n
 
* molecular-weight:
 
** 626.524
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9518]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8228]]
+
* [[RXN-9516]]
 +
* [[RXN-9648]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=a 3-oxo-hexanoyl-[acp]}}
{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
 
{{#set: molecular-weight=626.524}}
 

Revision as of 08:29, 15 March 2021

Metabolite 3-oxo-hexanoyl-ACPs

  • common-name:
    • a 3-oxo-hexanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-hexanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.