Difference between revisions of "DIETHYLPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13172 == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c(=o)(c1(o)(c=cccc(=o)1))[o-] * inchi-key: ** wezwwzku...") |
(Created page with "Category:metabolite == Metabolite DIETHYLPHOSPHATE == * common-name: ** diethylphosphate * smiles: ** ccop(=o)([o-])occ * inchi-key: ** ucqfcfpecqilol-uhfffaoysa-m * molec...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIETHYLPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** diethylphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccop(=o)([o-])occ |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ucqfcfpecqilol-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.094 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8746]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=diethylphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ucqfcfpecqilol-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.094}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIETHYLPHOSPHATE
- common-name:
- diethylphosphate
- smiles:
- ccop(=o)([o-])occ
- inchi-key:
- ucqfcfpecqilol-uhfffaoysa-m
- molecular-weight:
- 153.094
