Difference between revisions of "DIHYDRO-DIOH-BENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17480 RXN-17480] == * direction: ** left-to-right * common-name: ** bacteriohlorophyll b syntha...")
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17480 RXN-17480] ==
+
== Metabolite DIHYDRO-DIOH-BENZOATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** bacteriohlorophyll b synthase
+
** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.133 ec-2.5.1.133]
+
** c([o-])(=o)c1(=cc=cc(c1o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-18885]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-18890]][c] '''+''' 1 [[PPI]][c]
+
** incswykiciyahb-wdskdsinsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07213]]
+
** 155.13
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DHBDEHYD-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7762]], bacteriochlorophyll b biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7762 PWY-7762]
+
== Reaction(s) of unknown directionality ==
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=(2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=incswykiciyahb-wdskdsinsa-m}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=155.13}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=bacteriohlorophyll b synthase}}
 
−
{{#set: ec-number=ec-2.5.1.133}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite DIHYDRO-DIOH-BENZOATE

  • common-name:
    • (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate
  • smiles:
    • c([o-])(=o)c1(=cc=cc(c1o)o)
  • inchi-key:
    • incswykiciyahb-wdskdsinsa-m
  • molecular-weight:
    • 155.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIHYDRO-DIOH-BENZOATE&oldid=139592"