Difference between revisions of "DIHYDRO-NEO-PTERIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == * common-name: ** an l-1-phosphatidylethanolamine == Reaction(s) known to consume the compound == * 2....") |
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRO-NEO-PTERIN == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydroneopterin |
| + | * smiles: | ||
| + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) | ||
| + | * inchi-key: | ||
| + | ** yqifamynggotfb-xinawcovsa-n | ||
| + | * molecular-weight: | ||
| + | ** 255.233 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[H2NEOPTERINALDOL-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin}} |
| + | {{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}} | ||
| + | {{#set: molecular-weight=255.233}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DIHYDRO-NEO-PTERIN
- common-name:
- 7,8-dihydroneopterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-xinawcovsa-n
- molecular-weight:
- 255.233
