Difference between revisions of "DIHYDRO-NEO-PTERIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11238 == * transcription-direction: ** positive * right-end-position: ** 355814 * left-end-position: ** 345192 * centisome-position: ** 91.59907...")
 
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11238 ==
+
== Metabolite DIHYDRO-NEO-PTERIN ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 7,8-dihydroneopterin
−
* right-end-position:
+
* smiles:
−
** 355814
+
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
−
* left-end-position:
+
* inchi-key:
−
** 345192
+
** yqifamynggotfb-xinawcovsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 91.59907   
+
** 255.233
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[H2NEOPTERINALDOL-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-15117]]
+
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=7,8-dihydroneopterin}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}}
−
* [[RXN-5464]]
+
{{#set: molecular-weight=255.233}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7817]]
 
−
** '''6''' reactions found over '''16''' reactions in the full pathway
 
−
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=355814}}
 
−
{{#set: left-end-position=345192}}
 
−
{{#set: centisome-position=91.59907    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite DIHYDRO-NEO-PTERIN

  • common-name:
    • 7,8-dihydroneopterin
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
  • inchi-key:
    • yqifamynggotfb-xinawcovsa-n
  • molecular-weight:
    • 255.233

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIHYDRO-NEO-PTERIN&oldid=136722"