Difference between revisions of "DIHYDRO-NEO-PTERIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02171 == * transcription-direction: ** negative * right-end-position: ** 183054 * left-end-position: ** 181131 * centisome-position: ** 33.326466...") |
(Created page with "Category:metabolite == Metabolite DIHYDRO-NEO-PTERIN == * common-name: ** 7,8-dihydroneopterin * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) * inchi-key: ** yqifam...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDRO-NEO-PTERIN == |
− | * | + | * common-name: |
− | ** | + | ** 7,8-dihydroneopterin |
− | * | + | * smiles: |
− | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) |
− | * | + | * inchi-key: |
− | ** | + | ** yqifamynggotfb-xinawcovsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 255.233 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[H2NEOPTERINALDOL-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=7,8-dihydroneopterin}} | |
− | + | {{#set: inchi-key=inchikey=yqifamynggotfb-xinawcovsa-n}} | |
− | + | {{#set: molecular-weight=255.233}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DIHYDRO-NEO-PTERIN
- common-name:
- 7,8-dihydroneopterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-xinawcovsa-n
- molecular-weight:
- 255.233