Difference between revisions of "DIHYDROFOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13930 == * common-name: ** (z)-2-methyl-peroxyaminoacrylate * smiles: ** cc(=cn)c(=o)oo * inchi-key: ** dyysamfojrgamq-ihwypqmzsa-n *...") |
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROFOLATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydrofolate monoglutamate |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ozrnssudzolusn-lbprgkrzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 441.402 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHFR2i]] | ||
| + | * [[DHFRi]] | ||
| + | * [[MDUMT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DHFOR]] |
| − | * [[ | + | * [[DIHYDROFOLATESYNTH-RXN]] |
| + | * [[FOLR2]] | ||
| + | * [[MDUMT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydrofolate monoglutamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=441.402}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROFOLATE
- common-name:
- 7,8-dihydrofolate monoglutamate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
- inchi-key:
- ozrnssudzolusn-lbprgkrzsa-l
- molecular-weight:
- 441.402
