Difference between revisions of "DIHYDROFOLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Introns == * common-name: ** a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus == Reaction(s) known to consume...")
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Introns ==
+
== Metabolite DIHYDROFOLATE ==
 
* common-name:
 
* common-name:
** a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus
+
** 7,8-dihydrofolate monoglutamate
 +
* smiles:
 +
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
 +
* inchi-key:
 +
** ozrnssudzolusn-lbprgkrzsa-l
 +
* molecular-weight:
 +
** 441.402
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DHFR2i]]
 +
* [[DHFRi]]
 +
* [[MDUMT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.27.9-RXN]]
+
* [[DHFOR]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
* [[FOLR2]]
 +
* [[MDUMT]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trna intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus}}
+
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
 +
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
 +
{{#set: molecular-weight=441.402}}

Latest revision as of 11:15, 18 March 2021

Metabolite DIHYDROFOLATE

  • common-name:
    • 7,8-dihydrofolate monoglutamate
  • smiles:
    • c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
  • inchi-key:
    • ozrnssudzolusn-lbprgkrzsa-l
  • molecular-weight:
    • 441.402

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality