Difference between revisions of "DIHYDROFOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite R-3-hydroxyhexanoyl-ACPs == * common-name: ** a (3r)-3-hydroxyhexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9520...") |
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROFOLATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydrofolate monoglutamate |
+ | * smiles: | ||
+ | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) | ||
+ | * inchi-key: | ||
+ | ** ozrnssudzolusn-lbprgkrzsa-l | ||
+ | * molecular-weight: | ||
+ | ** 441.402 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DHFR2i]] |
+ | * [[DHFRi]] | ||
+ | * [[MDUMT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DHFOR]] |
+ | * [[DIHYDROFOLATESYNTH-RXN]] | ||
+ | * [[FOLR2]] | ||
+ | * [[MDUMT]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7,8-dihydrofolate monoglutamate}} |
+ | {{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}} | ||
+ | {{#set: molecular-weight=441.402}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROFOLATE
- common-name:
- 7,8-dihydrofolate monoglutamate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
- inchi-key:
- ozrnssudzolusn-lbprgkrzsa-l
- molecular-weight:
- 441.402