Difference between revisions of "DIHYDROFOLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] == * direction: ** left-to-right * ec-numb...")
 
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RNA-3-PHOSPHATE-CYCLASE-RXN RNA-3-PHOSPHATE-CYCLASE-RXN] ==
+
== Metabolite DIHYDROFOLATE ==
* direction:
+
* common-name:
** left-to-right
+
** 7,8-dihydrofolate monoglutamate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/6.5.1.4 ec-6.5.1.4]
+
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
== Reaction formula ==
+
* inchi-key:
* 1 [[3-Prime-Phosphate-Terminated-RNAs]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Cyclic-Phosphate-Terminated-RNAs]][c] '''+''' 1 [[PPI]][c]
+
** ozrnssudzolusn-lbprgkrzsa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12279]]
+
** 441.402
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DHFR2i]]
== Pathway(s) ==
+
* [[DHFRi]]
== Reconstruction information  ==
+
* [[MDUMT]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[DHFOR]]
* RHEA:
+
* [[DIHYDROFOLATESYNTH-RXN]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23977 23977]
+
* [[FOLR2]]
* LIGAND-RXN:
+
* [[MDUMT]]
** [http://www.genome.jp/dbget-bin/www_bget?R04274 R04274]
+
== Reaction(s) of unknown directionality ==
* UNIPROT:
+
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
** [http://www.uniprot.org/uniprot/Q9V0Z6 Q9V0Z6]
+
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
** [http://www.uniprot.org/uniprot/O00442 O00442]
+
{{#set: molecular-weight=441.402}}
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-6.5.1.4}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite DIHYDROFOLATE

  • common-name:
    • 7,8-dihydrofolate monoglutamate
  • smiles:
    • c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
  • inchi-key:
    • ozrnssudzolusn-lbprgkrzsa-l
  • molecular-weight:
    • 441.402

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality