Difference between revisions of "DIHYDROFOLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-HYDROXYPHYTANOYL-COA == * common-name: ** 2-hydroxyphytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite CPD-15530 == * common-name: ** aldehydo-d-glucuronate * smiles: ** [ch](=o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** iajilqketjexlj-qtbdo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-HYDROXYPHYTANOYL-COA ==
+
== Metabolite CPD-15530 ==
 
* common-name:
 
* common-name:
** 2-hydroxyphytanoyl-coa
+
** aldehydo-d-glucuronate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [ch](=o)c(o)c(o)c(o)c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** wnvfjmypvbolkv-ylnukallsa-j
+
** iajilqketjexlj-qtbdoelssa-m
 
* molecular-weight:
 
* molecular-weight:
** 1074.021
+
** 193.133
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLUCURONATE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.11.18-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxyphytanoyl-coa}}
+
{{#set: common-name=aldehydo-d-glucuronate}}
{{#set: inchi-key=inchikey=wnvfjmypvbolkv-ylnukallsa-j}}
+
{{#set: inchi-key=inchikey=iajilqketjexlj-qtbdoelssa-m}}
{{#set: molecular-weight=1074.021}}
+
{{#set: molecular-weight=193.133}}

Revision as of 15:29, 5 January 2021

Metabolite CPD-15530

  • common-name:
    • aldehydo-d-glucuronate
  • smiles:
    • [ch](=o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • iajilqketjexlj-qtbdoelssa-m
  • molecular-weight:
    • 193.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality