|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTMPKI-RXN DTMPKI-RXN] == | + | == Metabolite DIHYDROFOLATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** dtmp kinase | + | ** 7,8-dihydrofolate monoglutamate |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.4.12 ec-2.7.4.12] | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) |
| − | ** [http://enzyme.expasy.org/EC/2.7.4.13 ec-2.7.4.13] | + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/2.7.4.9 ec-2.7.4.9]
| + | ** ozrnssudzolusn-lbprgkrzsa-l |
| − | == Reaction formula == | + | * molecular-weight: |
| − | * 1 [[ATP]][c] '''+''' 1 [[TMP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[TDP]][c]
| + | ** 441.402 |
| − | == Gene(s) associated with this reaction == | + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ01455]] | + | * [[DHFR2i]] |
| − | ** Category: [[annotation]] | + | * [[DHFRi]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[MDUMT]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[DHFOR]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[DIHYDROFOLATESYNTH-RXN]] |
| − | == Pathway(s) == | + | * [[FOLR2]] |
| − | * [[PWY-7184]], pyrimidine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184] | + | * [[MDUMT]] |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | == Reaction(s) of unknown directionality == |
| − | * [[PWY-6545]], pyrimidine deoxyribonucleotides de novo biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545] | + | {{#set: common-name=7,8-dihydrofolate monoglutamate}} |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}} |
| − | * [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187] | + | {{#set: molecular-weight=441.402}} |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
| |
| − | ** '''14''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7210]], pyrimidine deoxyribonucleotides biosynthesis from CTP: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7198]], pyrimidine deoxyribonucleotides de novo biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7198 PWY-7198] | |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7197]], pyrimidine deoxyribonucleotide phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197] | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13518 13518]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02094 R02094]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q57741 Q57741]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPF3 Q9PPF3]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A720 P0A720]
| |
| − | ** [http://www.uniprot.org/uniprot/Q8X8H7 Q8X8H7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JVE7 Q9JVE7]
| |
| − | ** [http://www.uniprot.org/uniprot/P33803 P33803]
| |
| − | ** [http://www.uniprot.org/uniprot/P42490 P42490]
| |
| − | ** [http://www.uniprot.org/uniprot/P00572 P00572]
| |
| − | ** [http://www.uniprot.org/uniprot/Q80HT9 Q80HT9]
| |
| − | ** [http://www.uniprot.org/uniprot/P68693 P68693]
| |
| − | ** [http://www.uniprot.org/uniprot/P23919 P23919]
| |
| − | ** [http://www.uniprot.org/uniprot/P36590 P36590]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9RA29 Q9RA29]
| |
| − | ** [http://www.uniprot.org/uniprot/O81650 O81650]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=dtmp kinase}} | |
| − | {{#set: ec-number=ec-2.7.4.12|ec-2.7.4.9|ec-2.7.4.13}} | |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=7}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
