Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...")
(Created page with "Category:metabolite == Metabolite BCCP-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * BIOTI...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INDOLEYL-CPD ==
+
== Metabolite BCCP-L-lysine ==
 
* common-name:
 
* common-name:
** (indole-3-yl)acetonitrile
+
** a [biotin carboxyl-carrier protein]-l-lysine
* smiles:
 
** c(#n)cc1(=cnc2(c=cc=cc1=2))
 
* inchi-key:
 
** dmcpfobljmlsnx-uhfffaoysa-n
 
* molecular-weight:
 
** 156.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1404]]
+
* [[BIOTINLIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(indole-3-yl)acetonitrile}}
+
{{#set: common-name=a [biotin carboxyl-carrier protein]-l-lysine}}
{{#set: inchi-key=inchikey=dmcpfobljmlsnx-uhfffaoysa-n}}
 
{{#set: molecular-weight=156.187}}
 

Revision as of 08:25, 15 March 2021

Metabolite BCCP-L-lysine

  • common-name:
    • a [biotin carboxyl-carrier protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.