Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
(Created page with "Category:metabolite == Metabolite BCCP-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * BIOTI...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BCCP-L-lysine == |
* common-name: | * common-name: | ||
− | ** | + | ** a [biotin carboxyl-carrier protein]-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[BIOTINLIG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [biotin carboxyl-carrier protein]-l-lysine}} |
− | |||
− |
Revision as of 08:25, 15 March 2021
Contents
Metabolite BCCP-L-lysine
- common-name:
- a [biotin carboxyl-carrier protein]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.