Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BCCP-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * BIOTI...") |
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROKAEMPFEROL-CMPD == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-dihydrokaempferol |
| + | * smiles: | ||
| + | ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) | ||
| + | * inchi-key: | ||
| + | ** padqinqhpqkxnl-lsdhhaiusa-n | ||
| + | * molecular-weight: | ||
| + | ** 288.256 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
| + | * [[RXN1F-93]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-dihydrokaempferol}} |
| + | {{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}} | ||
| + | {{#set: molecular-weight=288.256}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- common-name:
- (+)-dihydrokaempferol
- smiles:
- c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
- inchi-key:
- padqinqhpqkxnl-lsdhhaiusa-n
- molecular-weight:
- 288.256
