Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13626 == * transcription-direction: ** negative * right-end-position: ** 77748 * left-end-position: ** 67125 * centisome-position: ** 20.19125...") |
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DIHYDROKAEMPFEROL-CMPD == |
| − | * | + | * common-name: |
| − | ** | + | ** (+)-dihydrokaempferol |
| − | * | + | * smiles: |
| − | ** | + | ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** padqinqhpqkxnl-lsdhhaiusa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 288.256 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
| − | == Reaction(s) | + | * [[RXN1F-93]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | {{#set: common-name=(+)-dihydrokaempferol}} |
| − | + | {{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}} | |
| − | + | {{#set: molecular-weight=288.256}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- common-name:
- (+)-dihydrokaempferol
- smiles:
- c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
- inchi-key:
- padqinqhpqkxnl-lsdhhaiusa-n
- molecular-weight:
- 288.256
