Difference between revisions of "DIHYDROKAEMPFEROL-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17268 == * transcription-direction: ** positive * right-end-position: ** 144617 * left-end-position: ** 140756 * centisome-position: ** 52.858955...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == * common-name: ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide |
| − | + | * smiles: | |
| − | + | ** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3) | |
| − | + | * inchi-key: | |
| − | + | ** qoushgmtbiiahr-keohhstqsa-j | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 573.303 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[PRIBFAICARPISOM-RXN]] | |
| − | == | + | * [[PRICI]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[HISTCYCLOHYD-RXN]] |
| − | *** | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}} |
| − | * | + | {{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}} |
| − | + | {{#set: molecular-weight=573.303}} | |
| − | == | ||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P
- common-name:
- 1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
- smiles:
- c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
- inchi-key:
- qoushgmtbiiahr-keohhstqsa-j
- molecular-weight:
- 573.303
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(5-phospho-β-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
