Difference between revisions of "DIHYDROLIPOAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...") |
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOAMIDE == * common-name: ** dihydrolipoamide * smiles: ** c(ccc(n)=o)cc(s)ccs * inchi-key: ** vlyugyakyzetrf-ssdottswsa-n * mol...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROLIPOAMIDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrolipoamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccc(n)=o)cc(s)ccs |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vlyugyakyzetrf-ssdottswsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 207.348 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[AKGDHe2r]] | ||
| + | * [[DIHYDLIPACETRANS-RXN]] | ||
| + | * [[PDHe3mr]] | ||
| + | * [[RXN-18331]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[AKGDHe2r]] |
| + | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] | ||
| + | * [[DHRT_LPAREN_ibcoa_RPAREN_]] | ||
| + | * [[PDHe3mr]] | ||
| + | * [[RXN-18331]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrolipoamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vlyugyakyzetrf-ssdottswsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=207.348}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite DIHYDROLIPOAMIDE
- common-name:
- dihydrolipoamide
- smiles:
- c(ccc(n)=o)cc(s)ccs
- inchi-key:
- vlyugyakyzetrf-ssdottswsa-n
- molecular-weight:
- 207.348
