Difference between revisions of "DIHYDROLIPOYL-GCVH"

Revision as of 11:15, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD3DJ-11366 ==
+== Metabolite GLC-1-P ==
 * common-name:
-** sphingosine 1-phosphate
+** &alpha;-d-glucopyranose 1-phosphate
 * smiles:
-** cccccccccccccc=cc(o)c([n+])cop(=o)([o-])[o-]
+** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 * inchi-key:
-** duysyhssbdvjsm-krwokugfsa-m
+** hxxfsfrbohsimq-vfuothlcsa-l
 * molecular-weight:
-** 378.468
+** 258.121
 == Reaction(s) known to consume the compound ==
-* [[RXN3DJ-11230]]
+* [[GALACTURIDYLYLTRANS-RXN]]
-* [[RXN3DJ-25]]
+* [[GLUC1PURIDYLTRANS-RXN]]
+* [[PGCM]]
+* [[PGMTh]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN-12486]]
+* [[RXN-16997]]
+* [[RXN4FS-13]]
+* [[UG1PUT]]
 == Reaction(s) known to produce the compound ==
-* [[RXN3DJ-11417]]
+* [[GALACTURIDYLYLTRANS-RXN]]
+* [[GLUC1PURIDYLTRANS-RXN]]
+* [[GLYCOPHOSPHORYL-RXN]]
+* [[GLYMALTOPHOSPHORYL-RXN]]
+* [[PGCM]]
+* [[PGMTh]]
+* [[PHOSPHOGLUCMUT-RXN]]
+* [[RXN-12171]]
+* [[RXN-12392]]
+* [[RXN-12486]]
+* [[RXN-14284]]
+* [[RXN-14285]]
+* [[RXN-14286]]
+* [[RXN-14353]]
+* [[RXN-1826]]
+* [[RXN-9025]]
+* [[RXN0-5182]]
+* [[RXN0-5184]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=sphingosine 1-phosphate}}
+{{#set: common-name=&alpha;-d-glucopyranose 1-phosphate}}
-{{#set: inchi-key=inchikey=duysyhssbdvjsm-krwokugfsa-m}}
+{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
-{{#set: molecular-weight=378.468}}
+{{#set: molecular-weight=258.121}}