Difference between revisions of "DIHYDROLIPOYL-GCVH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...") |
(Created page with "Category:metabolite == Metabolite DIHYDROLIPOYL-GCVH == * common-name: ** a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine == Reaction(s) known to consume...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROLIPOYL-GCVH == |
* common-name: | * common-name: | ||
− | ** | + | ** a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GCVT-RXN]] |
− | * [[ | + | * [[RXN-8629]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GCVT-RXN]] |
− | + | * [[RXN-8629]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite DIHYDROLIPOYL-GCVH
- common-name:
- a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-dihydrolipoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.