Difference between revisions of "DIHYDRONEOPTERIN-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11740 == * common-name: ** carboxyphosphinopyruvate * smiles: ** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** ytkwpnbypyowcp...") |
(Created page with "Category:metabolite == Metabolite Keratan-sulfate-NAcGlcN6S == * common-name: ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consu...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Keratan-sulfate-NAcGlcN6S == |
* common-name: | * common-name: | ||
− | ** | + | ** [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11570]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate}} |
− | |||
− |
Revision as of 11:15, 15 January 2021
Contents
Metabolite Keratan-sulfate-NAcGlcN6S
- common-name:
- [keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "keratan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.