Difference between revisions of "DIHYDRONEOPTERIN-P3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...") |
(Created page with "Category:metabolite == Metabolite Uracil17-in-tRNAs == * common-name: ** a uracil17 in trna == Reaction(s) known to consume the compound == * RXN-12455 == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Uracil17-in-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uracil17 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12455]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uracil17 in trna}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Uracil17-in-tRNAs
- common-name:
- a uracil17 in trna
