Difference between revisions of "DIHYDRONEOPTERIN-P3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-641 == * common-name: ** (r)-mevalonate diphosphate * smiles: ** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-] * inchi-key: ** sigq...")
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-641 ==
+
== Metabolite DIHYDRONEOPTERIN-P3 ==
 
* common-name:
 
* common-name:
** (r)-mevalonate diphosphate
+
** 7,8-dihydroneopterin 3'-triphosphate
 
* smiles:
 
* smiles:
** cc(o)(ccop(=o)([o-])op([o-])([o-])=o)cc(=o)[o-]
+
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
 
* inchi-key:
 
* inchi-key:
** sigqqubjqxsamw-zcfiwibfsa-j
+
** dgguvlxvlhaagt-xinawcovsa-j
 
* molecular-weight:
 
* molecular-weight:
** 304.087
+
** 491.141
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+
* [[4.2.3.12-RXN]]
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
* [[GTP-CYCLOHYDRO-I-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-mevalonate diphosphate}}
+
{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
{{#set: inchi-key=inchikey=sigqqubjqxsamw-zcfiwibfsa-j}}
+
{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
{{#set: molecular-weight=304.087}}
+
{{#set: molecular-weight=491.141}}

Latest revision as of 11:15, 18 March 2021

Metabolite DIHYDRONEOPTERIN-P3

  • common-name:
    • 7,8-dihydroneopterin 3'-triphosphate
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
  • inchi-key:
    • dgguvlxvlhaagt-xinawcovsa-j
  • molecular-weight:
    • 491.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality