Difference between revisions of "DIHYDRONEOPTERIN-P3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Uracil17-in-tRNAs == * common-name: ** a uracil17 in trna == Reaction(s) known to consume the compound == * RXN-12455 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRONEOPTERIN-P3 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydroneopterin 3'-triphosphate |
| + | * smiles: | ||
| + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2)) | ||
| + | * inchi-key: | ||
| + | ** dgguvlxvlhaagt-xinawcovsa-j | ||
| + | * molecular-weight: | ||
| + | ** 491.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[4.2.3.12-RXN]] |
| + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GTP-CYCLOHYDRO-I-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}} |
| + | {{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}} | ||
| + | {{#set: molecular-weight=491.141}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDRONEOPTERIN-P3
- common-name:
- 7,8-dihydroneopterin 3'-triphosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
- inchi-key:
- dgguvlxvlhaagt-xinawcovsa-j
- molecular-weight:
- 491.141
