Difference between revisions of "DIHYDRONEOPTERIN-P3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.1-RXN 3.1.4.1-RXN] == * direction: ** left-to-right * common-name: ** phosphodiesterase i * e...")
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.1-RXN 3.1.4.1-RXN] ==
+
== Metabolite DIHYDRONEOPTERIN-P3 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** phosphodiesterase i
+
** 7,8-dihydroneopterin 3'-triphosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.4.1 ec-3.1.4.1]
+
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
== Reaction formula ==
+
* inchi-key:
* 1 [[Oligonucleotides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Nucleoside-Monophosphates]][c] '''+''' 1 [[Oligonucleotides]][c]
+
** dgguvlxvlhaagt-xinawcovsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ17438]]
+
** 491.141
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[4.2.3.12-RXN]]
* Gene: [[SJ08994]]
+
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GTP-CYCLOHYDRO-I-RXN]]
* Gene: [[SJ04992]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
* Gene: [[SJ05463]]
+
{{#set: molecular-weight=491.141}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P15396 P15396]
 
** [http://www.uniprot.org/uniprot/P22413 P22413]
 
** [http://www.uniprot.org/uniprot/Q64610 Q64610]
 
** [http://www.uniprot.org/uniprot/P97675 P97675]
 
** [http://www.uniprot.org/uniprot/P06229 P06229]
 
** [http://www.uniprot.org/uniprot/Q8IZH2 Q8IZH2]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=phosphodiesterase i}}
 
{{#set: ec-number=ec-3.1.4.1}}
 
{{#set: nb gene associated=4}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite DIHYDRONEOPTERIN-P3

  • common-name:
    • 7,8-dihydroneopterin 3'-triphosphate
  • smiles:
    • c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
  • inchi-key:
    • dgguvlxvlhaagt-xinawcovsa-j
  • molecular-weight:
    • 491.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality