Difference between revisions of "DIHYDRONEOPTERIN-P3"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.1-RXN 3.1.4.1-RXN] == * direction: ** left-to-right * common-name: ** phosphodiesterase i * e...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDRONEOPTERIN-P3 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydroneopterin 3'-triphosphate |
− | * | + | * smiles: |
− | ** | + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2)) |
− | == | + | * inchi-key: |
− | + | ** dgguvlxvlhaagt-xinawcovsa-j | |
− | = | + | * molecular-weight: |
− | * | + | ** 491.141 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[4.2.3.12-RXN]] |
− | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}} |
− | * | + | {{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}} |
− | + | {{#set: molecular-weight=491.141}} | |
− | |||
− | |||
− | == | ||
− | |||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDRONEOPTERIN-P3
- common-name:
- 7,8-dihydroneopterin 3'-triphosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
- inchi-key:
- dgguvlxvlhaagt-xinawcovsa-j
- molecular-weight:
- 491.141