Difference between revisions of "DIHYDRONEOPTERIN-P3"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-D2-ENOYL-COA == * common-name: ** a cis-2-enoyl-coa == Reaction(s) known to consume the compound == * RXN-17475 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDRONEOPTERIN-P3 == |
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydroneopterin 3'-triphosphate |
+ | * smiles: | ||
+ | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2)) | ||
+ | * inchi-key: | ||
+ | ** dgguvlxvlhaagt-xinawcovsa-j | ||
+ | * molecular-weight: | ||
+ | ** 491.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[4.2.3.12-RXN]] |
+ | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}} |
+ | {{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}} | ||
+ | {{#set: molecular-weight=491.141}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDRONEOPTERIN-P3
- common-name:
- 7,8-dihydroneopterin 3'-triphosphate
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
- inchi-key:
- dgguvlxvlhaagt-xinawcovsa-j
- molecular-weight:
- 491.141