Difference between revisions of "DIHYDROSIROHYDROCHLORIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11033 == * transcription-direction: ** negative * right-end-position: ** 288302 * left-end-position: ** 283888 * centisome-position: ** 36.143127...")
 
(Created page with "Category:metabolite == Metabolite DIHYDROSIROHYDROCHLORIN == * common-name: ** precorrin-2 * smiles: ** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11033 ==
+
== Metabolite DIHYDROSIROHYDROCHLORIN ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** precorrin-2
−
* right-end-position:
+
* smiles:
−
** 288302
+
** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-])
−
* left-end-position:
+
* inchi-key:
−
** 283888
+
** oqiiyzqttmkfau-znloqlqnsa-g
−
* centisome-position:
+
* molecular-weight:
−
** 36.143127   
+
** 857.803
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DIMETHUROPORDEHYDROG-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-8759]]
−
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[RXN-13403]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-8675]]
−
* [[UGD-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=precorrin-2}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=oqiiyzqttmkfau-znloqlqnsa-g}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=857.803}}
−
* [[PWY-6073]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6082]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7346]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-7820]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=288302}}
 
−
{{#set: left-end-position=283888}}
 
−
{{#set: centisome-position=36.143127    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite DIHYDROSIROHYDROCHLORIN

  • common-name:
    • precorrin-2
  • smiles:
    • cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-])
  • inchi-key:
    • oqiiyzqttmkfau-znloqlqnsa-g
  • molecular-weight:
    • 857.803

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIHYDROSIROHYDROCHLORIN&oldid=136674"