Difference between revisions of "DIHYDROSIROHYDROCHLORIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ == * common-name: ** 5-(2-hydroxyethyl)-4-methylthiazole * smiles: ** cc1(n=csc(cco)=1) * inchi-key: ** bkawjirckvuved-uhfffaoysa-n *...") |
(Created page with "Category:metabolite == Metabolite DIHYDROSIROHYDROCHLORIN == * common-name: ** precorrin-2 * smiles: ** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROSIROHYDROCHLORIN == |
* common-name: | * common-name: | ||
− | ** | + | ** precorrin-2 |
* smiles: | * smiles: | ||
− | ** cc1( | + | ** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oqiiyzqttmkfau-znloqlqnsa-g |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 857.803 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIMETHUROPORDEHYDROG-RXN]] |
+ | * [[RXN-8759]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13403]] |
+ | * [[RXN-8675]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=precorrin-2}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oqiiyzqttmkfau-znloqlqnsa-g}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=857.803}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite DIHYDROSIROHYDROCHLORIN
- common-name:
- precorrin-2
- smiles:
- cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-])
- inchi-key:
- oqiiyzqttmkfau-znloqlqnsa-g
- molecular-weight:
- 857.803