Difference between revisions of "DIHYDROXY-BUTANONE-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-adrenergic-receptors == * common-name: ** a β-adrenergic receptor == Reaction(s) known to consume the compound == * 2.7.11.15...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * smiles: ** cc(=o)c(o)cop(=o)([o-])[o-] * inchi-key: *...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROXY-BUTANONE-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-deoxy-l-glycero-tetrulose 4-phosphate |
| + | * smiles: | ||
| + | ** cc(=o)c(o)cop(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** okyhyxlctggolm-scsaibsysa-l | ||
| + | * molecular-weight: | ||
| + | ** 182.069 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LUMAZINESYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-deoxy-l-glycero-tetrulose 4-phosphate}} |
| + | {{#set: inchi-key=inchikey=okyhyxlctggolm-scsaibsysa-l}} | ||
| + | {{#set: molecular-weight=182.069}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXY-BUTANONE-P
- common-name:
- 1-deoxy-l-glycero-tetrulose 4-phosphate
- smiles:
- cc(=o)c(o)cop(=o)([o-])[o-]
- inchi-key:
- okyhyxlctggolm-scsaibsysa-l
- molecular-weight:
- 182.069
