Difference between revisions of "DIHYDROXY-BUTANONE-P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R223-RXN R223-RXN] == * direction: ** left-to-right * common-name: ** octanoyl-coa ligase ** acyl-c...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * smiles: ** cc(=o)c(o)cop(=o)([o-])[o-] * inchi-key: *...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDROXY-BUTANONE-P == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 1-deoxy-l-glycero-tetrulose 4-phosphate |
− | + | * smiles: | |
− | + | ** cc(=o)c(o)cop(=o)([o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** okyhyxlctggolm-scsaibsysa-l |
− | = | + | * molecular-weight: |
− | + | ** 182.069 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[LUMAZINESYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DIOHBUTANONEPSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-deoxy-l-glycero-tetrulose 4-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=okyhyxlctggolm-scsaibsysa-l}} | |
− | + | {{#set: molecular-weight=182.069}} | |
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXY-BUTANONE-P
- common-name:
- 1-deoxy-l-glycero-tetrulose 4-phosphate
- smiles:
- cc(=o)c(o)cop(=o)([o-])[o-]
- inchi-key:
- okyhyxlctggolm-scsaibsysa-l
- molecular-weight:
- 182.069