Difference between revisions of "DIHYDROXYACETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cis-Delta7-tetradecenoyl-ACPs == * common-name: ** a cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compound == * [...") |
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-129 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-carotene |
+ | * smiles: | ||
+ | ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c | ||
+ | * inchi-key: | ||
+ | ** oenhqhleoonyie-jltxgrslsa-n | ||
+ | * molecular-weight: | ||
+ | ** 536.882 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13641]] |
+ | * [[RXN-8025]] | ||
+ | * [[RXN1F-152]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13641]] |
+ | * [[RXN1F-151]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-carotene}} |
+ | {{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}} | ||
+ | {{#set: molecular-weight=536.882}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD1F-129
- common-name:
- β-carotene
- smiles:
- cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
- inchi-key:
- oenhqhleoonyie-jltxgrslsa-n
- molecular-weight:
- 536.882