Difference between revisions of "DIHYDROXYACETONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * mol...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYACETONE == * common-name: ** dihydroxyacetone * smiles: ** c(c(co)=o)o * inchi-key: ** rxkjfzqqpqgtfl-uhfffaoysa-n * molecular-w...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROXYACETONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydroxyacetone |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(c(co)=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rxkjfzqqpqgtfl-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 90.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLYCERONE-KINASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydroxyacetone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rxkjfzqqpqgtfl-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=90.079}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXYACETONE
- common-name:
- dihydroxyacetone
- smiles:
- c(c(co)=o)o
- inchi-key:
- rxkjfzqqpqgtfl-uhfffaoysa-n
- molecular-weight:
- 90.079
