Difference between revisions of "DIHYDROXYNAPHTHOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5881 == * common-name: ** (6r)-4a-hydroxy-tetrahydrobiopterin * smiles: ** cc(o)c(o)[ch]1(cnc2(=nc(n)=nc(=o)c(o)(n1)2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROXYNAPHTHOATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-carboxy-1,4-naphthoquinol |
* smiles: | * smiles: | ||
− | ** | + | ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vojuxhhacrxltd-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 203.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NPHS]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-carboxy-1,4-naphthoquinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.174}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXYNAPHTHOATE
- common-name:
- 2-carboxy-1,4-naphthoquinol
- smiles:
- c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
- inchi-key:
- vojuxhhacrxltd-uhfffaoysa-m
- molecular-weight:
- 203.174