Difference between revisions of "DIHYDROXYPHENYLGLYCOLALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Thi-S == * common-name: ** a this sulfur-carrier protein == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxyphenylglycolaldehyde |
| + | * smiles: | ||
| + | ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) | ||
| + | * inchi-key: | ||
| + | ** yugmcljiwgekck-qmmmgpobsa-n | ||
| + | * molecular-weight: | ||
| + | ** 168.149 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10911]] | ||
| + | * [[RXN-10912]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10907]] |
| + | * [[RXN-10908]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}} |
| + | {{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}} | ||
| + | {{#set: molecular-weight=168.149}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE
- common-name:
- 3,4-dihydroxyphenylglycolaldehyde
- smiles:
- c(=o)c(o)c1(c=cc(o)=c(o)c=1)
- inchi-key:
- yugmcljiwgekck-qmmmgpobsa-n
- molecular-weight:
- 168.149
