Difference between revisions of "DIHYDROXYPHENYLGLYCOLALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPKIN-RXN GDPKIN-RXN] == * direction: ** left-to-right * common-name: ** nucleoside diphosphate ki...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDPKIN-RXN GDPKIN-RXN] ==
+
== Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** nucleoside diphosphate kinase
+
** 3,4-dihydroxyphenylglycolaldehyde
−
** gdp kinase
+
* smiles:
−
* ec-number:
+
** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
−
** [http://enzyme.expasy.org/EC/2.7.4.6 ec-2.7.4.6]
+
* inchi-key:
−
== Reaction formula ==
+
** yugmcljiwgekck-qmmmgpobsa-n
−
* 1 [[ATP]][c] '''+''' 1 [[GDP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GTP]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 168.149
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ20076]]
+
* [[RXN-10911]]
−
** Category: [[annotation]]
+
* [[RXN-10912]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ10125]]
+
* [[RXN-10907]]
−
** Category: [[annotation]]
+
* [[RXN-10908]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=168.149}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ07124]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ21816]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ08159]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ20794]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ21967]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ16893]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ21705]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PPGPPMET-PWY]], ppGpp biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PPGPPMET-PWY PPGPPMET-PWY]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27687 27687]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00330 R00330]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=nucleoside diphosphate kinase|gdp kinase}}
 
−
{{#set: ec-number=ec-2.7.4.6}}
 
−
{{#set: nb gene associated=9}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylglycolaldehyde
  • smiles:
    • c(=o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • yugmcljiwgekck-qmmmgpobsa-n
  • molecular-weight:
    • 168.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIHYDROXYPHENYLGLYCOLALDEHYDE&oldid=138992"