Difference between revisions of "DIHYDROXYPHENYLGLYCOLALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-700 == * common-name: ** ergosta-5,7,24(28)-trien-3β-ol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc=c1(cc(o)ccc(c)1[ch]2cc...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,4-dihydroxyphenylglycolaldehyde |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yugmcljiwgekck-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 168.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10911]] |
+ | * [[RXN-10912]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10907]] |
+ | * [[RXN-10908]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.149}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE
- common-name:
- 3,4-dihydroxyphenylglycolaldehyde
- smiles:
- c(=o)c(o)c1(c=cc(o)=c(o)c=1)
- inchi-key:
- yugmcljiwgekck-qmmmgpobsa-n
- molecular-weight:
- 168.149