Difference between revisions of "DIMETHYL-D-RIBITYL-LUMAZINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...") |
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-UCP-E2-L-cysteine == * common-name: ** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine == Reaction(s) known t...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite S-ubiquitinyl-UCP-E2-L-cysteine == |
* common-name: | * common-name: | ||
− | ** | + | ** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15559]] |
− | + | * [[RXN-15561]] | |
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15556]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite S-ubiquitinyl-UCP-E2-L-cysteine
- common-name:
- an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.