Difference between revisions of "DIMETHYL-GLYCINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...")
(Created page with "Category:metabolite == Metabolite DIMETHYL-GLYCINE == * common-name: ** n,n-dimethylglycine * smiles: ** c[n+](cc([o-])=o)c * inchi-key: ** ffdgpvchzbvarc-uhfffaoysa-n * m...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15924 ==
+
== Metabolite DIMETHYL-GLYCINE ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-lyso-glycerone phosphate
+
** n,n-dimethylglycine
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
+
** c[n+](cc([o-])=o)c
 
* inchi-key:
 
* inchi-key:
** yzkfnnqaebncen-ktkrtigzsa-l
+
** ffdgpvchzbvarc-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 432.493
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 +
* [[RXN-9680]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15044]]
+
* [[2.1.1.5-RXN]]
 +
* [[RXN-13404]]
 +
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
 +
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
 +
* [[RXN-9679]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}}
+
{{#set: common-name=n,n-dimethylglycine}}
{{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}}
+
{{#set: inchi-key=inchikey=ffdgpvchzbvarc-uhfffaoysa-n}}
{{#set: molecular-weight=432.493}}
+
{{#set: molecular-weight=103.121}}

Latest revision as of 11:15, 18 March 2021

Metabolite DIMETHYL-GLYCINE

  • common-name:
    • n,n-dimethylglycine
  • smiles:
    • c[n+](cc([o-])=o)c
  • inchi-key:
    • ffdgpvchzbvarc-uhfffaoysa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality