Difference between revisions of "DIMETHYL-GLYCINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.11-RXN 1.5.1.11-RXN] == * direction: ** left-to-right * common-name: ** d-octopine dehydrogen...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.5.1.11-RXN 1.5.1.11-RXN] ==
+
== Metabolite 2-OCTAPRENYLPHENOL ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** d-octopine dehydrogenase
+
** 2-octaprenylphenol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.5.1.11 ec-1.5.1.11]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ARG]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRUVATE]][c] '''=>''' 1 [[CPD-309]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c]
+
** vunqjppptjiren-cmaxttdksa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15888]]
+
** 639.058
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7351]], pyruvate fermentation to opines: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7351 PWY-7351]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
{{#set: common-name=2-octaprenylphenol}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=639.058}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16287 16287]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00562 R00562]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=d-octopine dehydrogenase}}
 
−
{{#set: ec-number=ec-1.5.1.11}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DIMETHYL-GLYCINE&oldid=47323"