Difference between revisions of "DIMETHYL-GLYCINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Lipid-hydroxy-fatty-acids == * common-name: ** a hydroxy-fatty-acyl-[lipid] == Reaction(s) known to consume the compound == == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15924 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleoyl-2-lyso-glycerone phosphate |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o | ||
| + | * inchi-key: | ||
| + | ** yzkfnnqaebncen-ktkrtigzsa-l | ||
| + | * molecular-weight: | ||
| + | ** 432.493 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15044]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}} |
| + | {{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}} | ||
| + | {{#set: molecular-weight=432.493}} | ||
Revision as of 15:28, 5 January 2021
Contents
Metabolite CPD-15924
- common-name:
- 1-oleoyl-2-lyso-glycerone phosphate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
- inchi-key:
- yzkfnnqaebncen-ktkrtigzsa-l
- molecular-weight:
- 432.493
