Difference between revisions of "DIMETHYLARSINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * smiles: ** c(o)c2(=nc1(c(=o)nc(n)=nc=1...")
(Created page with "Category:metabolite == Metabolite Long-Chain-3S-Hydroxyacyl-CoAs == * common-name: ** a long-chain (3s)-3-hydroxyacyl-coa == Reaction(s) known to consume the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE ==
+
== Metabolite Long-Chain-3S-Hydroxyacyl-CoAs ==
 
* common-name:
 
* common-name:
** 6-(hydroxymethyl)-7,8-dihydropterin
+
** a long-chain (3s)-3-hydroxyacyl-coa
* smiles:
 
** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
 
* inchi-key:
 
** cqqnnqtxugluev-uhfffaoysa-n
 
* molecular-weight:
 
** 195.18
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
* [[1.1.1.211-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2NEOPTERINALDOL-RXN]]
+
* [[1.1.1.211-RXN]]
* [[RXN-10857]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
+
{{#set: common-name=a long-chain (3s)-3-hydroxyacyl-coa}}
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
 
{{#set: molecular-weight=195.18}}
 

Revision as of 11:19, 15 January 2021

Metabolite Long-Chain-3S-Hydroxyacyl-CoAs

  • common-name:
    • a long-chain (3s)-3-hydroxyacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality