Difference between revisions of "DIMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ferrohemoglobins == * common-name: ** a ferrohemoglobin == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
(Created page with "Category:metabolite == Metabolite CPD-458 == * common-name: ** galactinol * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o * inchi-key: ** vcwmrqdbpzkxkg-xidcd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ferrohemoglobins ==
+
== Metabolite CPD-458 ==
 
* common-name:
 
* common-name:
** a ferrohemoglobin
+
** galactinol
 +
* smiles:
 +
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
 +
* inchi-key:
 +
** vcwmrqdbpzkxkg-xidcdeprsa-n
 +
* molecular-weight:
 +
** 342.299
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.67-RXN]]
 +
* [[2.4.1.82-RXN]]
 +
* [[RXN-8281]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11195]]
+
* [[2.4.1.123-RXN]]
 +
* [[2.4.1.67-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ferrohemoglobin}}
+
{{#set: common-name=galactinol}}
 +
{{#set: inchi-key=inchikey=vcwmrqdbpzkxkg-xidcdeprsa-n}}
 +
{{#set: molecular-weight=342.299}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-458

  • common-name:
    • galactinol
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
  • inchi-key:
    • vcwmrqdbpzkxkg-xidcdeprsa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality