Difference between revisions of "DIMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00403 == * transcription-direction: ** positive * right-end-position: ** 466328 * left-end-position: ** 459419 * centisome-position: ** 80.90328...") |
(Created page with "Category:metabolite == Metabolite DIMP == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** phngfppxdjjadg-rrkc...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIMP == |
− | * | + | * common-name: |
− | ** | + | ** dimp |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** phngfppxdjjadg-rrkcrqdmsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 330.193 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN0-1602]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=dimp}} | |
− | + | {{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}} | |
− | + | {{#set: molecular-weight=330.193}} | |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DIMP
- common-name:
- dimp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- phngfppxdjjadg-rrkcrqdmsa-l
- molecular-weight:
- 330.193