Difference between revisions of "DIMP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-behenoyl-ACPs == * common-name: ** a 3-oxo-behenoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-157 * RXN1G...") |
(Created page with "Category:metabolite == Metabolite DIMP == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** phngfppxdjjadg-rrkc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIMP == |
* common-name: | * common-name: | ||
− | ** | + | ** dimp |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** phngfppxdjjadg-rrkcrqdmsa-l | ||
+ | * molecular-weight: | ||
+ | ** 330.193 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-1602]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dimp}} |
+ | {{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}} | ||
+ | {{#set: molecular-weight=330.193}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite DIMP
- common-name:
- dimp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- phngfppxdjjadg-rrkcrqdmsa-l
- molecular-weight:
- 330.193