Difference between revisions of "DIPHOSPHO-1D-MYO-INOSITOL-TETRAKISPHOSPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-acyl-sphingosylphosphorylcholine == * common-name: ** an n-acyl-sphingosylphosphorylcholine == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-acyl-sphingosylphosphorylcholine ==
+
== Metabolite CPD-3709 ==
 
* common-name:
 
* common-name:
** an n-acyl-sphingosylphosphorylcholine
+
** guanosine 2',3'-cyclic monophosphate
 +
* smiles:
 +
** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
 +
* inchi-key:
 +
** uasryodfrywbrc-uuokfmhzsa-m
 +
* molecular-weight:
 +
** 344.2
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15212]]
+
* [[RXN-12058]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15211]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-acyl-sphingosylphosphorylcholine}}
+
{{#set: common-name=guanosine 2',3'-cyclic monophosphate}}
 +
{{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}}
 +
{{#set: molecular-weight=344.2}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-3709

  • common-name:
    • guanosine 2',3'-cyclic monophosphate
  • smiles:
    • c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
  • inchi-key:
    • uasryodfrywbrc-uuokfmhzsa-m
  • molecular-weight:
    • 344.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality