Difference between revisions of "DIPHTHAMIDE"

Revision as of 18:53, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD0-2108 ==
+== Metabolite SER ==
 * common-name:
-** (2e)-oct-2-enoyl-coa
+** l-serine
 * smiles:
-** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+** c(o)c([n+])c(=o)[o-]
 * inchi-key:
-** cpsdnaxxkwvyiy-ntlmcjqisa-j
+** mtcfgrxmjlqnbg-reohclbhsa-n
 * molecular-weight:
-** 887.685
+** 105.093
 == Reaction(s) known to consume the compound ==
-* [[RXN-14229]]
+* [[4.3.1.17-RXN]]
-* [[RXN-14276]]
+* [[5.1.1.18-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[GLYOHMETRANS-RXN]]
+* [[PHOSPHASERSYN-RXN]]
+* [[RXN-1382]]
+* [[RXN-15125]]
+* [[RXN0-2161]]
+* [[RXN0-2382]]
+* [[SERINE--TRNA-LIGASE-RXN]]
+* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
+* [[SERINE-O-ACETTRAN-RXN]]
+* [[TRYPSYN-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ACOA80OR]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
-* [[RXN-12669]]
+* [[GLYOHMETRANS-RXN]]
-* [[RXN-14229]]
+* [[PHOSPHASERSYN-RXN]]
+* [[RXN-1382]]
+* [[RXN-14136]]
+* [[RXN0-5114]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e)-oct-2-enoyl-coa}}
+{{#set: common-name=l-serine}}
-{{#set: inchi-key=inchikey=cpsdnaxxkwvyiy-ntlmcjqisa-j}}
+{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-reohclbhsa-n}}
-{{#set: molecular-weight=887.685}}
+{{#set: molecular-weight=105.093}}